CymitQuimica logo

CAS 1186194-41-1

:

1H-Indole-3-butanamine, 2-(3-quinolinyl)-, hydrochloride (1:1)

Description:
1H-Indole-3-butanamine, 2-(3-quinolinyl)-, hydrochloride (1:1) is a chemical compound characterized by its indole and quinoline moieties, which contribute to its potential biological activity. The presence of the indole structure suggests that it may interact with various biological targets, possibly influencing neurotransmitter systems or exhibiting pharmacological properties. The hydrochloride salt form indicates that the compound is likely to be soluble in water, enhancing its bioavailability for potential therapeutic applications. This compound may be of interest in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric disorders. Its molecular structure suggests it could possess properties such as moderate lipophilicity, which is often favorable for crossing biological membranes. Additionally, the presence of both the indole and quinoline rings may provide opportunities for further chemical modifications to optimize its activity and selectivity. As with many compounds in this class, understanding its pharmacokinetics, toxicity, and mechanism of action would be essential for evaluating its potential use in clinical settings.
Formula:C21H21N3·ClH
InChI:InChI=1S/C21H21N3.ClH/c22-12-6-5-9-18-17-8-2-4-11-20(17)24-21(18)16-13-15-7-1-3-10-19(15)23-14-16;/h1-4,7-8,10-11,13-14,24H,5-6,9,12,22H2;1H
InChI key:InChIKey=YUGTXJWWFYCJNN-UHFFFAOYSA-N
SMILES:C(CCCN)C1=C(NC=2C1=CC=CC2)C3=CC4=C(N=C3)C=CC=C4.Cl
Synonyms:
  • 1H-Indole-3-butanamine, 2-(3-quinolinyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.