CymitQuimica logo

CAS 1186194-58-0

:

Phenol, 4-(difluoromethyl)-, 1-propanoate

Description:
Phenol, 4-(difluoromethyl)-, 1-propanoate, with the CAS number 1186194-58-0, is an organic compound characterized by its phenolic structure, which includes a difluoromethyl group and a propanoate moiety. This compound typically exhibits properties associated with both phenols and esters, including moderate solubility in organic solvents and potential reactivity due to the presence of the difluoromethyl group, which can influence its chemical behavior and interactions. The difluoromethyl group may enhance lipophilicity and alter the compound's biological activity, making it of interest in medicinal chemistry and agrochemical applications. Additionally, the ester functional group suggests that it may undergo hydrolysis under certain conditions, leading to the release of phenol and propanoic acid. Overall, the unique combination of functional groups in this compound contributes to its potential utility in various chemical and pharmaceutical applications, although specific reactivity and stability would depend on environmental conditions and the presence of other reactants.
Formula:C10H10F2O2
InChI:InChI=1S/C10H10F2O2/c1-2-9(13)14-8-5-3-7(4-6-8)10(11)12/h3-6,10H,2H2,1H3
InChI key:InChIKey=OBEJMWROBFNQIA-UHFFFAOYSA-N
SMILES:O(C(CC)=O)C1=CC=C(C(F)F)C=C1
Synonyms:
  • Phenol, 4-(difluoromethyl)-, 1-propanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.