
CAS 1186194-70-6
:N-[(4-Fluorophenyl)methyl]-N-[[4-(phenylmethoxy)phenyl]methyl]-5-(trifluoromethyl)-1H-imidazole-2-methanamine
Description:
N-[(4-Fluorophenyl)methyl]-N-[[4-(phenylmethoxy)phenyl]methyl]-5-(trifluoromethyl)-1H-imidazole-2-methanamine is a complex organic compound characterized by its imidazole core, which is a five-membered heterocyclic structure containing nitrogen atoms. This compound features multiple functional groups, including a trifluoromethyl group, which enhances its lipophilicity and may influence its biological activity. The presence of fluorine and methoxy groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's structure indicates it may exhibit interesting interactions with biological targets, possibly acting as an inhibitor or modulator in various biochemical pathways. Its molecular weight, solubility, and stability would depend on the specific arrangement of its substituents and the overall molecular conformation. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in research or industry.
Formula:C26H23F4N3O
InChI:InChI=1S/C26H23F4N3O/c27-22-10-6-19(7-11-22)15-33(17-25-31-14-24(32-25)26(28,29)30)16-20-8-12-23(13-9-20)34-18-21-4-2-1-3-5-21/h1-14H,15-18H2,(H,31,32)
InChI key:InChIKey=LSGIKALAEWJAFI-UHFFFAOYSA-N
SMILES:N(CC=1NC(C(F)(F)F)=CN1)(CC2=CC=C(OCC3=CC=CC=C3)C=C2)CC4=CC=C(F)C=C4
Synonyms:- N-[(4-Fluorophenyl)methyl]-N-[[4-(phenylmethoxy)phenyl]methyl]-5-(trifluoromethyl)-1H-imidazole-2-methanamine
- 1H-Imidazole-2-methanamine, N-[(4-fluorophenyl)methyl]-N-[[4-(phenylmethoxy)phenyl]methyl]-5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.