CAS 1186194-80-8

1-Bromo-4-fluoro-2-(2,2,2-trifluoroethyl)benzene

Description:

1-Bromo-4-fluoro-2-(2,2,2-trifluoroethyl)benzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a bromine atom, a fluorine atom, and a trifluoroethyl group. The presence of these halogen substituents significantly influences its chemical properties, including reactivity and polarity. The bromine and fluorine atoms can enhance the compound's electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. The trifluoroethyl group contributes to the compound's lipophilicity and can affect its solubility in organic solvents. This compound may exhibit unique physical properties, such as a distinct boiling point and melting point, influenced by the steric and electronic effects of the halogens. Additionally, due to the presence of multiple fluorine atoms, it may have applications in fields such as pharmaceuticals, agrochemicals, or materials science, where fluorinated compounds are often sought for their stability and specific interactions. Safety and handling precautions are essential due to the potential toxicity of halogenated compounds.

Formula: C₈H₅BrF₄

InChI: InChI=1S/C8H5BrF4/c9-7-2-1-6(10)3-5(7)4-8(11,12)13/h1-3H,4H2

InChI key: InChIKey=VDKXBQCWYHXJNB-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)C1=C(Br)C=CC(F)=C1

Synonyms:

• 1-Bromo-4-fluoro-2-(2,2,2-trifluoroethyl)benzene
• Benzene, 1-bromo-4-fluoro-2-(2,2,2-trifluoroethyl)-