CAS 1186194-99-9

Ethanimidamide, 2-[[4-(trifluoromethyl)phenyl]sulfonyl]-, hydrochloride (1:1)

Description:

Ethanimidamide, 2-[[4-(trifluoromethyl)phenyl]sulfonyl]-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide structure, which includes a sulfonyl group attached to a phenyl ring that is further substituted with a trifluoromethyl group. This compound is typically encountered as a hydrochloride salt, indicating the presence of hydrochloric acid in its formulation, which enhances its solubility in water. The trifluoromethyl group contributes to the compound's lipophilicity and may influence its biological activity, making it of interest in pharmaceutical applications. Ethanimidamide derivatives are often studied for their potential therapeutic effects, particularly in the context of enzyme inhibition or as intermediates in drug synthesis. The presence of the sulfonamide moiety is significant, as it is known for its antibacterial properties and role in various medicinal chemistry applications. Safety and handling precautions are essential due to the potential reactivity and toxicity associated with fluorinated compounds.

Formula: C₉H₉F₃N₂O₂S·ClH

InChI: InChI=1S/C9H9F3N2O2S.ClH/c10-9(11,12)6-1-3-7(4-2-6)17(15,16)5-8(13)14;/h1-4H,5H2,(H3,13,14);1H

InChI key: InChIKey=CQUTYUFAHMTSMO-UHFFFAOYSA-N

SMILES: S(CC(=N)N)(=O)(=O)C1=CC=C(C(F)(F)F)C=C1.Cl

Synonyms:

• Ethanimidamide, 2-[[4-(trifluoromethyl)phenyl]sulfonyl]-, hydrochloride (1:1)