CymitQuimica logo

CAS 1186195-13-0

:

Pyridine, 2-(2,2,2-trifluoroethyl)-

Description:
Pyridine, 2-(2,2,2-trifluoroethyl)-, is a fluorinated derivative of pyridine, characterized by the presence of a trifluoroethyl group attached to the second carbon of the pyridine ring. This compound typically exhibits a colorless to pale yellow liquid form and possesses a distinctive, somewhat pungent odor. The trifluoroethyl group contributes to its unique chemical properties, including increased lipophilicity and potential reactivity in various chemical reactions. Pyridine derivatives are known for their applications in organic synthesis, pharmaceuticals, and agrochemicals, and the introduction of trifluoromethyl groups can enhance biological activity or alter the compound's solubility. The presence of fluorine atoms often imparts stability and resistance to metabolic degradation, making such compounds of interest in medicinal chemistry. Additionally, the compound's polar nature may influence its interactions in biological systems and its behavior in various solvents. Safety data should be consulted for handling, as fluorinated compounds can exhibit toxicity and environmental persistence.
Formula:C7H6F3N
InChI:InChI=1S/C7H6F3N/c8-7(9,10)5-6-3-1-2-4-11-6/h1-4H,5H2
InChI key:InChIKey=MKFDWZKRIACKMS-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)C1=CC=CC=N1
Synonyms:
  • Pyridine, 2-(2,2,2-trifluoroethyl)-
  • 2-(2,2,2-Trifluoroethyl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.