
CAS 1186195-16-3
:1-(Difluoromethyl)pyrene
Description:
1-(Difluoromethyl)pyrene is a polycyclic aromatic hydrocarbon (PAH) derivative characterized by the presence of a difluoromethyl group attached to the pyrene structure. This compound typically exhibits a high degree of hydrophobicity due to its large aromatic system, which can influence its solubility and interaction with biological systems. The difluoromethyl group introduces unique electronic and steric properties, potentially affecting its reactivity and stability. As a PAH, it may also be subject to environmental persistence and bioaccumulation concerns. The compound's fluorescence properties can be significant, making it useful in various applications, including organic electronics and as a fluorescent probe in biochemical assays. Additionally, its potential toxicity and environmental impact warrant careful handling and assessment in research and industrial contexts. Overall, 1-(difluoromethyl)pyrene represents a fascinating area of study within the field of organic chemistry, particularly in the context of functionalized aromatic compounds.
Formula:C17H10F2
InChI:InChI=1S/C17H10F2/c18-17(19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9,17H
InChI key:InChIKey=IYMSRSKFOPLGAV-UHFFFAOYSA-N
SMILES:C(F)(F)C1=C2C3=C4C(C=C2)=CC=CC4=CC=C3C=C1
Synonyms:- Pyrene, 1-(difluoromethyl)-
- 1-(Difluoromethyl)pyrene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.