CAS 1186195-18-5

9-(Difluoromethyl)phenanthrene

Description:

9-(Difluoromethyl)phenanthrene is an organic compound characterized by its phenanthrene backbone, which is a polycyclic aromatic hydrocarbon. The presence of a difluoromethyl group at the 9-position introduces unique chemical properties, including increased reactivity and potential for specific interactions in various chemical environments. This compound is typically non-polar due to its aromatic structure, which can influence its solubility in organic solvents. The difluoromethyl group enhances the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry and materials science. Additionally, the presence of fluorine atoms can impart stability and alter the electronic properties of the molecule, potentially influencing its behavior in chemical reactions. As with many polycyclic aromatic hydrocarbons, 9-(Difluoromethyl)phenanthrene may exhibit fluorescence, making it useful in applications such as organic light-emitting diodes (OLEDs) and other optoelectronic devices. Safety and handling considerations are essential, as fluorinated compounds can pose environmental and health risks.

Formula: C₁₅H₁₀F₂

InChI: InChI=1S/C15H10F2/c16-15(17)14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9,15H

InChI key: InChIKey=MHDIZQVBSLSBJO-UHFFFAOYSA-N

SMILES: C(F)(F)C1=C2C(=C3C(=C1)C=CC=C3)C=CC=C2

Synonyms:

• 9-(Difluoromethyl)phenanthrene
• Phenanthrene, 9-(difluoromethyl)-