CymitQuimica logo

CAS 1186195-22-1

:

4-(1,1-Difluoropropyl)pyridine

Description:
4-(1,1-Difluoropropyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a 1,1-difluoropropyl substituent at the fourth position of the pyridine ring introduces unique properties, including increased lipophilicity and potential reactivity due to the fluorine atoms. This compound is likely to exhibit moderate polarity due to the electronegative fluorine atoms, which can influence its solubility in various solvents. Additionally, the difluoropropyl group may enhance the compound's stability and alter its interaction with biological systems, making it of interest in pharmaceutical applications. The compound's molecular structure suggests potential uses in agrochemicals or as a building block in organic synthesis. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices. Overall, 4-(1,1-Difluoropropyl)pyridine represents a versatile compound with potential applications in various fields of chemistry and material science.
Formula:C8H9F2N
InChI:InChI=1S/C8H9F2N/c1-2-8(9,10)7-3-5-11-6-4-7/h3-6H,2H2,1H3
InChI key:InChIKey=ZOPDIUBJCVLBFT-UHFFFAOYSA-N
SMILES:C(CC)(F)(F)C=1C=CN=CC1
Synonyms:
  • Pyridine, 4-(1,1-difluoropropyl)-
  • 4-(1,1-Difluoropropyl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.