
CAS 1186195-44-7
:1,1-Difluoro-4-pentylcyclohexane
Description:
1,1-Difluoro-4-pentylcyclohexane is a fluorinated organic compound characterized by the presence of two fluorine atoms and a pentyl group attached to a cyclohexane ring. The molecular structure features a cyclohexane backbone, which is a saturated six-membered carbon ring, providing stability and a relatively low reactivity compared to unsaturated compounds. The difluoro substitution at the 1-position introduces significant polarity and can influence the compound's physical properties, such as boiling point and solubility. The pentyl group, a five-carbon straight-chain alkyl group, contributes to the hydrophobic character of the molecule, affecting its interactions with other substances. This compound may exhibit unique properties due to the combination of fluorine's electronegativity and the hydrophobic nature of the pentyl chain, making it of interest in various applications, including materials science and organic synthesis. However, specific data regarding its reactivity, toxicity, and environmental impact would require further investigation and analysis.
Formula:C11H20F2
InChI:InChI=1S/C11H20F2/c1-2-3-4-5-10-6-8-11(12,13)9-7-10/h10H,2-9H2,1H3
InChI key:InChIKey=AKBCNUYALVQUGW-UHFFFAOYSA-N
SMILES:C(CCCC)C1CCC(F)(F)CC1
Synonyms:- Cyclohexane, 1,1-difluoro-4-pentyl-
- 1,1-Difluoro-4-pentylcyclohexane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.