CAS 1186195-53-8
:Pyridine, 4-bromo-2-(trifluoromethyl)-, hydrochloride (1:1)
Description:
Pyridine, 4-bromo-2-(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and a trifluoromethyl group at the 2-position significantly influences its chemical reactivity and physical properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in polar solvents, particularly water. This compound may exhibit properties such as moderate to high toxicity, and it is important to handle it with care in a laboratory setting. Its unique structure allows it to participate in various chemical reactions, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the trifluoromethyl group can impart unique electronic properties, enhancing the compound's potential as a building block in complex molecular architectures. Safety data sheets should be consulted for specific handling and disposal guidelines.
Formula:C6H3BrF3N·ClH
InChI:InChI=1S/C6H3BrF3N.ClH/c7-4-1-2-11-5(3-4)6(8,9)10;/h1-3H;1H
InChI key:InChIKey=MGRXFENGOIPIPQ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(Br)=CC=N1.Cl
Synonyms:- Pyridine, 4-bromo-2-(trifluoromethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
