CAS 118630-28-7

2-(1-Piperazinylmethyl)quinoline

Description:

2-(1-Piperazinylmethyl)quinoline, identified by its CAS number 118630-28-7, is a chemical compound characterized by its unique structure that combines a quinoline moiety with a piperazine group. This compound typically exhibits properties such as moderate solubility in polar solvents and potential biological activity, making it of interest in medicinal chemistry. The presence of the piperazine ring often contributes to its pharmacological properties, including interactions with various receptors and enzymes. Additionally, the quinoline structure is known for its role in various biological activities, including antimicrobial and antimalarial effects. The compound may also display fluorescence properties, which can be useful in analytical applications. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-(1-Piperazinylmethyl)quinoline represents a class of compounds that are valuable in research and potential therapeutic applications, warranting further investigation into its specific biological effects and mechanisms of action.

Formula: C₁₄H₁₇N₃

InChI: InChI=1S/C14H17N3/c1-2-4-14-12(3-1)5-6-13(16-14)11-17-9-7-15-8-10-17/h1-6,15H,7-11H2

InChI key: InChIKey=VKUOCFNMBIBWEY-UHFFFAOYSA-N

SMILES: C(C1=NC2=C(C=C1)C=CC=C2)N3CCNCC3

Synonyms:

• Quinoline, 2-(1-piperazinylmethyl)-
• 2-(1-Piperazinylmethyl)quinoline