CymitQuimica logo

CAS 1186300-55-9

:

2-(3-Pyrrolidinyl)-2H-1,2,3-triazole

Description:
2-(3-Pyrrolidinyl)-2H-1,2,3-triazole is a chemical compound characterized by its unique triazole ring structure, which is a five-membered ring containing three nitrogen atoms and two carbon atoms. This compound features a pyrrolidine moiety, a five-membered saturated nitrogen-containing ring, which contributes to its biological activity and solubility properties. The presence of the triazole ring often imparts significant pharmacological properties, making such compounds of interest in medicinal chemistry, particularly for their potential as antifungal, antibacterial, or anticancer agents. The compound is typically synthesized through various organic reactions, including cycloaddition methods. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Additionally, the compound's reactivity can be influenced by the functional groups present, making it a versatile intermediate in organic synthesis. Overall, 2-(3-Pyrrolidinyl)-2H-1,2,3-triazole represents a class of compounds with significant potential in pharmaceutical applications.
Formula:C6H10N4
InChI:InChI=1S/C6H10N4/c1-2-7-5-6(1)10-8-3-4-9-10/h3-4,6-7H,1-2,5H2
InChI key:InChIKey=AKZQOVCQAJVWKM-UHFFFAOYSA-N
SMILES:C1(CCNC1)N2N=CC=N2
Synonyms:
  • 2-(3-Pyrrolidinyl)-2H-1,2,3-triazole
  • 2H-1,2,3-Triazole, 2-(3-pyrrolidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.