
CAS 1186307-20-9
:3,4-Dihydro-2H-1,4-benzoxazine-7-sulfonyl chloride
Description:
3,4-Dihydro-2H-1,4-benzoxazine-7-sulfonyl chloride is a chemical compound characterized by its unique structural features, which include a benzoxazine ring and a sulfonyl chloride functional group. This compound typically appears as a solid or crystalline material and is known for its reactivity due to the presence of the sulfonyl chloride moiety, which can participate in nucleophilic substitution reactions. The benzoxazine structure contributes to its potential applications in various fields, including pharmaceuticals and materials science, due to its ability to form stable polymers and its role as an intermediate in organic synthesis. Additionally, the compound may exhibit specific solubility characteristics, often being soluble in polar organic solvents. Safety precautions should be taken when handling this substance, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture. Overall, 3,4-Dihydro-2H-1,4-benzoxazine-7-sulfonyl chloride is a versatile compound with significant chemical reactivity and potential applications in synthetic chemistry.
Formula:C8H8ClNO3S
InChI:InChI=1S/C8H8ClNO3S/c9-14(11,12)6-1-2-7-8(5-6)13-4-3-10-7/h1-2,5,10H,3-4H2
InChI key:InChIKey=ZVFITCCNDJBOHZ-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C=1C=C2C(=CC1)NCCO2
Synonyms:- 2H-1,4-Benzoxazine-7-sulfonyl chloride, 3,4-dihydro-
- 3,4-Dihydro-2H-1,4-benzoxazine-7-sulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.