CAS 1186310-67-7

2-Chloro-3-(dimethoxymethyl)-4-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]pyridine

Description:

2-Chloro-3-(dimethoxymethyl)-4-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]pyridine, identified by its CAS number 1186310-67-7, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyridine ring substituted with various functional groups. The presence of a chlorine atom and a dimethoxymethyl group contributes to its reactivity and potential applications in organic synthesis. The dimethylsilyl group enhances its stability and solubility in organic solvents, making it useful in various chemical reactions. This compound may exhibit specific biological activities, which can be explored for potential pharmaceutical applications. Its unique combination of substituents suggests that it could participate in nucleophilic substitution reactions or serve as a precursor in the synthesis of more complex molecules. As with many organosilicon compounds, it may also display interesting properties related to its siloxane content, such as hydrophobicity. Overall, the characteristics of this compound make it a subject of interest in both synthetic chemistry and material science.

Formula: C₁₅H₂₆ClNO₃Si

InChI: InChI=1S/C15H26ClNO3Si/c1-15(2,3)21(6,7)20-10-11-8-9-17-13(16)12(11)14(18-4)19-5/h8-9,14H,10H2,1-7H3

InChI key: InChIKey=JITGZOPYNOGRBO-UHFFFAOYSA-N

SMILES: C(O[Si](C(C)(C)C)(C)C)C=1C(C(OC)OC)=C(Cl)N=CC1

Synonyms:

• 2-Chloro-3-(dimethoxymethyl)-4-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]pyridine
• Pyridine, 2-chloro-3-(dimethoxymethyl)-4-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-