CymitQuimica logo

CAS 1186310-68-8

:

5-Bromo-2-(4-morpholinyl)-3-pyridinamine

Description:
5-Bromo-2-(4-morpholinyl)-3-pyridinamine is a chemical compound characterized by its unique structure, which includes a bromine atom and a morpholine group attached to a pyridine ring. This compound typically exhibits properties associated with both aromatic and amine functionalities, contributing to its potential reactivity and solubility in various solvents. The presence of the bromine atom may enhance its electrophilic character, making it useful in substitution reactions. The morpholine moiety can impart basicity and may influence the compound's interaction with biological targets, suggesting potential applications in medicinal chemistry. Additionally, the pyridine ring is known for its role in coordination chemistry and can participate in hydrogen bonding due to the nitrogen atom in the ring. Overall, 5-Bromo-2-(4-morpholinyl)-3-pyridinamine is of interest in research and development, particularly in the fields of pharmaceuticals and agrochemicals, where its structural features may contribute to specific biological activities or chemical reactivity.
Formula:C9H12BrN3O
InChI:InChI=1S/C9H12BrN3O/c10-7-5-8(11)9(12-6-7)13-1-3-14-4-2-13/h5-6H,1-4,11H2
InChI key:InChIKey=BOWIGXGIQUXHAR-UHFFFAOYSA-N
SMILES:NC1=C(N2CCOCC2)N=CC(Br)=C1
Synonyms:
  • 3-Pyridinamine, 5-bromo-2-(4-morpholinyl)-
  • 5-Bromo-2-(morpholin-4-yl)pyridin-3-amine
  • 5-Bromo-2-morpholinopyridin-3-amine
  • 5-Bromo-2-(4-morpholinyl)-3-pyridinamine
  • 5-BROMO-2-MORPHOLIN-4-YL-PYRIDIN-3-YLAMINE
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.