CAS 1186310-69-9

2-Chloro-3-(dimethoxymethyl)-4-(2-propen-1-yl)pyridine

Description:

2-Chloro-3-(dimethoxymethyl)-4-(2-propen-1-yl)pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 2-position and a propenyl group at the 4-position introduces significant reactivity and potential for further chemical modifications. The dimethoxymethyl group at the 3-position enhances the compound's solubility and may influence its electronic properties. This compound is likely to exhibit polar characteristics due to the presence of the methoxy groups, which can engage in hydrogen bonding. Its structure suggests potential applications in organic synthesis, pharmaceuticals, or agrochemicals, particularly due to the reactivity of the propenyl group. Additionally, the chlorine substituent may impart unique biological activity or facilitate further functionalization. As with many pyridine derivatives, it may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Safety and handling precautions should be observed, as halogenated compounds can pose health risks.

Formula: C₁₁H₁₄ClNO₂

InChI: InChI=1S/C11H14ClNO2/c1-4-5-8-6-7-13-10(12)9(8)11(14-2)15-3/h4,6-7,11H,1,5H2,2-3H3

InChI key: InChIKey=ACMZFZNXZXPSLQ-UHFFFAOYSA-N

SMILES: C(OC)(OC)C=1C(CC=C)=CC=NC1Cl

Synonyms:

• Pyridine, 2-chloro-3-(dimethoxymethyl)-4-(2-propen-1-yl)-
• 2-Chloro-3-(dimethoxymethyl)-4-(2-propen-1-yl)pyridine