CymitQuimica logo

CAS 1186310-70-2

:

N-(1,2-Dihydro-5-iodo-2-oxo-3-pyridinyl)acetamide

Description:
N-(1,2-Dihydro-5-iodo-2-oxo-3-pyridinyl)acetamide is a chemical compound characterized by its pyridine ring structure, which is substituted at the 5-position with an iodine atom and features a 2-oxo group. The presence of the acetamide functional group indicates that it contains both an amide and an acetyl moiety, contributing to its potential biological activity. This compound may exhibit properties typical of pyridine derivatives, such as being polar and capable of forming hydrogen bonds, which can influence its solubility and reactivity. The iodine substitution can enhance its lipophilicity and may also affect its pharmacological properties. Compounds like this are often investigated for their potential therapeutic applications, particularly in medicinal chemistry, due to their ability to interact with biological targets. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values.
Formula:C7H7IN2O2
InChI:InChI=1S/C7H7IN2O2/c1-4(11)10-6-2-5(8)3-9-7(6)12/h2-3H,1H3,(H,9,12)(H,10,11)
InChI key:InChIKey=FBJQVCGPAZOJAE-UHFFFAOYSA-N
SMILES:N(C(C)=O)C=1C(=O)NC=C(I)C1
Synonyms:
  • N-(1,2-Dihydro-5-iodo-2-oxo-3-pyridinyl)acetamide
  • Acetamide, N-(1,2-dihydro-5-iodo-2-oxo-3-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.