CymitQuimica logo

CAS 1186310-73-5

:

6-Iodo-2-(trimethylsilyl)furo[3,2-b]pyridine

Description:
6-Iodo-2-(trimethylsilyl)furo[3,2-b]pyridine is a heterocyclic organic compound characterized by its unique fused ring structure, which incorporates both furan and pyridine moieties. The presence of the iodine atom at the 6-position contributes to its reactivity and potential applications in various chemical reactions, such as nucleophilic substitutions. The trimethylsilyl group at the 2-position enhances the compound's stability and solubility in organic solvents, making it useful in synthetic chemistry. This compound is typically utilized in medicinal chemistry and material science due to its ability to participate in further functionalization reactions. Its molecular structure allows for diverse interactions, which can be exploited in the development of pharmaceuticals or advanced materials. As with many halogenated compounds, safety precautions should be taken when handling it, as iodine can pose health risks. Overall, 6-Iodo-2-(trimethylsilyl)furo[3,2-b]pyridine is a versatile compound with significant potential in various chemical applications.
Formula:C10H12INOSi
InChI:InChI=1S/C10H12INOSi/c1-14(2,3)10-5-8-9(13-10)4-7(11)6-12-8/h4-6H,1-3H3
InChI key:InChIKey=ZEQJOLQKHFUOLN-UHFFFAOYSA-N
SMILES:[Si](C)(C)(C)C1=CC=2C(O1)=CC(I)=CN2
Synonyms:
  • 6-Iodo-2-(trimethylsilyl)furo[3,2-b]pyridine
  • Furo[3,2-b]pyridine, 6-iodo-2-(trimethylsilyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.