CAS 1186310-74-6
:Furo[3,2-b]pyridin-7-amine
Description:
Furo[3,2-b]pyridin-7-amine is a heterocyclic organic compound characterized by its fused ring structure, which includes a pyridine and a furan moiety. This compound features an amino group (-NH2) at the 7-position of the pyridine ring, contributing to its reactivity and potential biological activity. The presence of both nitrogen and oxygen in its structure allows for various interactions, making it of interest in medicinal chemistry and drug development. Furo[3,2-b]pyridin-7-amine may exhibit properties such as solubility in polar solvents, and its derivatives could possess diverse pharmacological activities, including anti-inflammatory or antimicrobial effects. The compound's unique structure can influence its electronic properties, stability, and interaction with biological targets. As with many heterocycles, the synthesis and characterization of this compound are crucial for understanding its potential applications in pharmaceuticals and materials science. Further studies may explore its reactivity, biological activity, and potential as a lead compound in drug discovery.
Formula:C7H6N2O
InChI:InChI=1S/C7H6N2O/c8-5-1-3-9-6-2-4-10-7(5)6/h1-4H,(H2,8,9)
InChI key:InChIKey=PUTFLLAMOPARNC-UHFFFAOYSA-N
SMILES:NC1=C2C(=NC=C1)C=CO2
Synonyms:- Furo[3,2-b]pyridin-7-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
