CAS 1186310-77-9

6-Chloro-2-(trimethylsilyl)furo[3,2-b]pyridine

Description:

6-Chloro-2-(trimethylsilyl)furo[3,2-b]pyridine is a heterocyclic organic compound characterized by its unique fused ring structure, which combines features of both furan and pyridine. The presence of a chlorine atom at the 6-position and a trimethylsilyl group at the 2-position contributes to its chemical reactivity and solubility properties. This compound is typically used in organic synthesis and medicinal chemistry due to its potential as a building block for more complex molecules. The trimethylsilyl group enhances the compound's stability and can facilitate various reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the furo-pyridine framework may exhibit interesting biological activities, making it a subject of interest in drug discovery. Its physical properties, such as melting point, boiling point, and solubility, can vary depending on the specific conditions and solvents used. Overall, 6-Chloro-2-(trimethylsilyl)furo[3,2-b]pyridine represents a versatile compound with applications in both research and industry.

Formula: C₁₀H₁₂ClNOSi

InChI: InChI=1S/C10H12ClNOSi/c1-14(2,3)10-5-8-9(13-10)4-7(11)6-12-8/h4-6H,1-3H3

InChI key: InChIKey=WUQLUIMCZRXJGD-UHFFFAOYSA-N

SMILES: [Si](C)(C)(C)C1=CC=2C(O1)=CC(Cl)=CN2

Synonyms:

• (6-Chlorofuro[3,2-b]pyridin-2-yl)-trimethylsilane
• 6-Chloro-2-(trimethylsilyl)furo[3,2-b]pyridine
• Furo[3,2-b]pyridine, 6-chloro-2-(trimethylsilyl)-

6-Chloro-2-(trimethylsilyl)furo[3,2-b]pyridine

CAS: 1186310-77-9

Purity: 95+%

Molecular weight: 225.75

Ref: 10-F734917