CAS 1186310-82-6

4-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-3-iodo-5-nitropyridine

Description:

The chemical substance known as 4-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-3-iodo-5-nitropyridine, with the CAS number 1186310-82-6, is a complex organic compound characterized by its unique structural features. It contains a pyridine ring substituted with an iodine atom and a nitro group, which contributes to its reactivity and potential biological activity. The presence of a pyrrolidine moiety suggests that it may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals. The dimethylsilyl group indicates that the compound may have applications in organosilicon chemistry, potentially influencing its solubility and stability. Additionally, the tert-butyl group enhances steric hindrance, which can affect the compound's interactions with biological targets. Overall, this compound's intricate structure and functional groups suggest it may possess interesting chemical properties and potential applications in various fields, including drug development and materials science.

Formula: C₁₆H₂₆IN₃O₃Si

InChI: InChI=1S/C16H26IN3O3Si/c1-16(2,3)24(4,5)23-11-12-6-7-19(10-12)15-13(17)8-18-9-14(15)20(21)22/h8-9,12H,6-7,10-11H2,1-5H3

InChI key: InChIKey=LDAXNEJQOMFZOT-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C(=C(I)C=NC1)N2CC(CO[Si](C(C)(C)C)(C)C)CC2

Synonyms:

• 4-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-3-iodo-5-nitropyridine
• Pyridine, 4-[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-3-iodo-5-nitro-
• 4-(3-((tert-Butyldimethylsilyloxy)methyl)-pyrrolidin-1-yl)-3-iodo-5-nitropyridine