CAS 1186310-83-7

N-[2-Chloro-3-[[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]methyl]-4-pyridinyl]-2,2-dimethylpropanamide

Description:

N-[2-Chloro-3-[[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]methyl]-4-pyridinyl]-2,2-dimethylpropanamide, with CAS number 1186310-83-7, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as amides, chlorines, and siloxanes. This compound features a pyridine ring, which contributes to its potential biological activity, and a dimethylsilyl group that may enhance its stability and solubility. The presence of a pyrrolidine moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its chlorinated structure may also influence its reactivity and pharmacokinetic properties. The compound is likely to be a solid at room temperature, with specific melting and boiling points dependent on its purity and crystalline form. As with many synthetic compounds, safety data and handling precautions are essential, particularly due to the presence of chlorine, which can pose health risks. Overall, this compound's unique characteristics make it a subject of interest for further research and potential applications in pharmaceuticals or agrochemicals.

Formula: C₂₂H₃₈ClN₃O₂Si

InChI: InChI=1S/C22H38ClN3O2Si/c1-21(2,3)20(27)25-18-9-11-24-19(23)17(18)14-26-12-10-16(13-26)15-28-29(7,8)22(4,5)6/h9,11,16H,10,12-15H2,1-8H3,(H,24,25,27)

InChI key: InChIKey=OTWNFIDIKYSBQC-UHFFFAOYSA-N

SMILES: C(C=1C(NC(C(C)(C)C)=O)=CC=NC1Cl)N2CC(CO[Si](C(C)(C)C)(C)C)CC2

Synonyms:

• N-[2-Chloro-3-[[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]methyl]-4-pyridinyl]-2,2-dimethylpropanamide
• Propanamide, N-[2-chloro-3-[[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]methyl]-4-pyridinyl]-2,2-dimethyl-