CAS 1186310-84-8
:5-Bromo-2-[[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]methyl]-3-methoxypyridine
Description:
5-Bromo-2-[[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]methyl]-3-methoxypyridine, identified by its CAS number 1186310-84-8, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyridine ring substituted with a bromine atom and a methoxy group. The presence of a pyrrolidine moiety and a silyl ether functional group contributes to its unique chemical properties, potentially influencing its reactivity and solubility. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its silyl group can enhance stability and protect reactive functionalities during synthesis or in biological environments. The bromine substituent can also serve as a site for further chemical modifications. Overall, the compound's characteristics suggest potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C18H31BrN2O2Si
InChI:InChI=1S/C18H31BrN2O2Si/c1-18(2,3)24(5,6)23-13-14-7-8-21(11-14)12-16-17(22-4)9-15(19)10-20-16/h9-10,14H,7-8,11-13H2,1-6H3
InChI key:InChIKey=YGGQFKNSXKOLDC-UHFFFAOYSA-N
SMILES:C(C1=C(OC)C=C(Br)C=N1)N2CC(CO[Si](C(C)(C)C)(C)C)CC2
Synonyms:- Pyridine, 5-bromo-2-[[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]methyl]-3-methoxy-
- 5-Bromo-2-[[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]methyl]-3-methoxypyridine
- 5-Bromo-2-((3-((tert-butyldimethylsilyloxy)methyl)pyrrolidin-1-yl)methyl)-3-methoxypyridine
- [1-[(5-bromo-3-methoxypyridin-2-yl)methyl]pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.