CAS 1186310-85-9
:5,6-Dimethoxy-3-pyridinol
Description:
5,6-Dimethoxy-3-pyridinol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of two methoxy groups (-OCH3) at the 5 and 6 positions of the pyridine ring contributes to its chemical properties, including increased lipophilicity and potential for hydrogen bonding. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents due to its methoxy substituents. It may participate in various chemical reactions, such as nucleophilic substitutions and electrophilic aromatic substitutions, owing to the electron-donating nature of the methoxy groups. Additionally, 5,6-Dimethoxy-3-pyridinol may have biological activity, making it of interest in pharmaceutical research. Its specific applications and reactivity can vary based on the context of use, including potential roles in medicinal chemistry or as an intermediate in organic synthesis. As with many pyridine derivatives, it is essential to handle this compound with care, following appropriate safety protocols.
Formula:C7H9NO3
InChI:InChI=1S/C7H9NO3/c1-10-6-3-5(9)4-8-7(6)11-2/h3-4,9H,1-2H3
InChI key:InChIKey=COWBNHGISFUPHE-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C=C(O)C=N1
Synonyms:- 5,6-Dimethoxy-3-pyridinol
- 3-Pyridinol, 5,6-dimethoxy-
- 5,6-Dimethoxypyridin-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.