CymitQuimica logo

CAS 1186310-88-2

:

N-[6-Iodo-2-(trimethylsilyl)furo[3,2-b]pyridin-7-yl]-2,2-dimethylpropanamide

Description:
N-[6-Iodo-2-(trimethylsilyl)furo[3,2-b]pyridin-7-yl]-2,2-dimethylpropanamide is a chemical compound characterized by its complex structure, which includes a furo[3,2-b]pyridine core substituted with an iodine atom and a trimethylsilyl group. This compound features an amide functional group, which contributes to its potential solubility and reactivity in various chemical environments. The presence of the iodine atom may impart unique electronic properties, making it useful in certain synthetic applications or as a precursor in medicinal chemistry. The trimethylsilyl group enhances the compound's stability and can influence its reactivity, particularly in nucleophilic substitution reactions. Additionally, the bulky 2,2-dimethylpropanamide moiety may affect the compound's steric properties, influencing its interactions with biological targets or other chemical species. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or materials science, although specific properties such as melting point, boiling point, and solubility would require empirical measurement for precise characterization.
Formula:C15H21IN2O2Si
InChI:InChI=1S/C15H21IN2O2Si/c1-15(2,3)14(19)18-12-9(16)8-17-10-7-11(20-13(10)12)21(4,5)6/h7-8H,1-6H3,(H,17,18,19)
InChI key:InChIKey=NQGXPZFYJZPDJR-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C1=C2C(C=C([Si](C)(C)C)O2)=NC=C1I
Synonyms:
  • N-[6-Iodo-2-(trimethylsilyl)furo[3,2-b]pyridin-7-yl]-2,2-dimethylpropanamide
  • Propanamide, N-[6-iodo-2-(trimethylsilyl)furo[3,2-b]pyridin-7-yl]-2,2-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.