CAS 1186310-92-8

5-Bromo-2-[2-(trimethylsilyl)ethynyl]-3-pyridinyl 1,1-dimethylethyl carbonate

Description:

5-Bromo-2-[2-(trimethylsilyl)ethynyl]-3-pyridinyl 1,1-dimethylethyl carbonate is a chemical compound characterized by its complex structure, which includes a pyridine ring, a bromine substituent, and a trimethylsilyl ethynyl group. This compound features a carbonate functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The trimethylsilyl group provides stability and solubility in organic solvents, facilitating its use in synthetic pathways. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the pyridine moiety's biological activity. Its unique combination of functional groups allows for diverse reactivity, making it a valuable intermediate in organic synthesis. As with many organic compounds, handling should be done with care, considering safety protocols due to potential toxicity and reactivity.

Formula: C₁₅H₂₀BrNO₃Si

InChI: InChI=1S/C15H20BrNO3Si/c1-15(2,3)20-14(18)19-13-9-11(16)10-17-12(13)7-8-21(4,5)6/h9-10H,1-6H3

InChI key: InChIKey=KVRNXNSZICMLQI-UHFFFAOYSA-N

SMILES: C(#C[Si](C)(C)C)C1=C(OC(OC(C)(C)C)=O)C=C(Br)C=N1

Synonyms:

• 5-Bromo-2-[2-(trimethylsilyl)ethynyl]-3-pyridinyl 1,1-dimethylethyl carbonate
• Carbonic acid, 5-bromo-2-[2-(trimethylsilyl)ethynyl]-3-pyridinyl 1,1-dimethylethyl ester