CymitQuimica logo

CAS 1186310-98-4

:

2-Chloro-3-(dimethoxymethyl)-4-pyridinecarbonitrile

Description:
2-Chloro-3-(dimethoxymethyl)-4-pyridinecarbonitrile is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a chloro substituent at the second position and a dimethoxymethyl group at the third position of the pyridine ring, along with a cyano group at the fourth position. The presence of the cyano group indicates potential reactivity, as nitriles can participate in various chemical reactions, including nucleophilic additions. The dimethoxymethyl group contributes to the compound's overall polarity and solubility characteristics, which can influence its behavior in different solvents. Additionally, the chloro substituent can affect the compound's reactivity and stability. Overall, this compound may exhibit interesting biological or pharmacological properties, making it of interest in medicinal chemistry and related fields. As with any chemical substance, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C9H9ClN2O2
InChI:InChI=1S/C9H9ClN2O2/c1-13-9(14-2)7-6(5-11)3-4-12-8(7)10/h3-4,9H,1-2H3
InChI key:InChIKey=GJWYBPKJLNAJEQ-UHFFFAOYSA-N
SMILES:C(OC)(OC)C=1C(C#N)=CC=NC1Cl
Synonyms:
  • 4-Pyridinecarbonitrile, 2-chloro-3-(dimethoxymethyl)-
  • 2-Chloro-3-(dimethoxymethyl)-4-pyridinecarbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.