CymitQuimica logo

CAS 1186311-01-2

:

4-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-5-iodo-3-pyridinamine

Description:
4-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-5-iodo-3-pyridinamine is a chemical compound characterized by its complex structure, which includes a pyridinamine core, a pyrrolidine ring, and a silyl ether functional group. The presence of iodine in the structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as halogenated compounds often exhibit unique biological activities. The dimethylsilyl group enhances the compound's stability and solubility, making it suitable for various chemical reactions and applications. Additionally, the tert-butyl group contributes to the steric bulk, which can influence the compound's reactivity and interaction with biological targets. Overall, this compound's unique combination of functional groups and structural features may provide interesting properties for research in organic synthesis and drug development. However, specific properties such as solubility, melting point, and reactivity would require empirical data for a comprehensive understanding.
Formula:C16H28IN3OSi
InChI:InChI=1S/C16H28IN3OSi/c1-16(2,3)22(4,5)21-11-12-6-7-20(10-12)15-13(17)8-19-9-14(15)18/h8-9,12H,6-7,10-11,18H2,1-5H3
InChI key:InChIKey=NQUOHPYVNRCUHP-UHFFFAOYSA-N
SMILES:IC=1C(=C(N)C=NC1)N2CC(CO[Si](C(C)(C)C)(C)C)CC2
Synonyms:
  • 4-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-5-iodo-3-pyridinamine
  • 3-Pyridinamine, 4-[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-5-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.