CymitQuimica logo

CAS 1186311-02-3

:

3-[[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]methyl]-5-iodopyridine

Description:
The chemical substance known as 3-[[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]methyl]-5-iodopyridine, with the CAS number 1186311-02-3, is characterized by its complex molecular structure, which includes a pyridine ring substituted with an iodine atom and a pyrrolidine moiety. The presence of a dimethylsilyl group indicates that it has potential applications in organosilicon chemistry, while the tert-butyl group contributes to its hydrophobic characteristics. This compound may exhibit unique reactivity due to the iodine substituent, which can participate in nucleophilic substitution reactions. Additionally, the silyl ether functionality suggests that it may be involved in various chemical transformations, including those related to silane chemistry. Its molecular structure implies potential uses in medicinal chemistry or as a building block in organic synthesis. However, specific properties such as solubility, melting point, and reactivity would require empirical data for precise characterization. Overall, this compound represents a versatile structure with potential applications in various fields of chemistry.
Formula:C17H29IN2OSi
InChI:InChI=1S/C17H29IN2OSi/c1-17(2,3)22(4,5)21-13-14-6-7-20(11-14)12-15-8-16(18)10-19-9-15/h8-10,14H,6-7,11-13H2,1-5H3
InChI key:InChIKey=CNCDNBJLDOIUGT-UHFFFAOYSA-N
SMILES:C(N1CC(CO[Si](C(C)(C)C)(C)C)CC1)C=2C=C(I)C=NC2
Synonyms:
  • Pyridine, 3-[[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]methyl]-5-iodo-
  • 3-[[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]methyl]-5-iodopyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.