CAS 1186311-03-4
:4-Methoxy-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-c]pyridine
Description:
4-Methoxy-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-c]pyridine is a chemical compound characterized by its unique structure, which includes a pyrrolo[2,3-c]pyridine core substituted with a methoxy group and a tris(1-methylethyl)silyl group. This compound is notable for its potential applications in organic synthesis and materials science due to the presence of the silyl group, which can enhance stability and reactivity. The methoxy group contributes to its solubility and may influence its electronic properties. The presence of the pyridine ring suggests potential interactions with various biological systems, making it of interest in medicinal chemistry. Additionally, the compound's silane functionality may facilitate cross-linking or polymerization reactions, expanding its utility in various chemical processes. Overall, 4-Methoxy-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-c]pyridine exemplifies a versatile structure that can be explored for diverse applications in both research and industry.
Formula:C17H28N2OSi
InChI:InChI=1S/C17H28N2OSi/c1-12(2)21(13(3)4,14(5)6)19-9-8-15-16(19)10-18-11-17(15)20-7/h8-14H,1-7H3
InChI key:InChIKey=YIDOPMFGWASYLK-UHFFFAOYSA-N
SMILES:[Si](C(C)C)(C(C)C)(C(C)C)N1C=2C(C=C1)=C(OC)C=NC2
Synonyms:- 4-Methoxy-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-c]pyridine
- 1H-Pyrrolo[2,3-c]pyridine, 4-methoxy-1-[tris(1-methylethyl)silyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.