CAS 1186311-04-5
:4-(Dimethoxymethyl)-1H-pyrrolo[2,3-b]pyridine
Description:
4-(Dimethoxymethyl)-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its pyrrolo[2,3-b]pyridine core structure, which consists of fused pyridine and pyrrole rings. This compound features a dimethoxymethyl substituent, which enhances its solubility and reactivity. Typically, compounds of this class exhibit interesting biological activities, making them of interest in medicinal chemistry. The presence of the dimethoxy group can influence the compound's electronic properties and steric hindrance, potentially affecting its interaction with biological targets. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and solvent polarity. Overall, 4-(Dimethoxymethyl)-1H-pyrrolo[2,3-b]pyridine represents a versatile scaffold for further chemical modifications and investigations into its pharmacological potential.
Formula:C10H12N2O2
InChI:InChI=1S/C10H12N2O2/c1-13-10(14-2)8-4-6-12-9-7(8)3-5-11-9/h3-6,10H,1-2H3,(H,11,12)
InChI key:InChIKey=DTEKUQUCTNGSRQ-UHFFFAOYSA-N
SMILES:C(OC)(OC)C1=C2C(NC=C2)=NC=C1
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine, 4-(dimethoxymethyl)-
- 4-(Dimethoxymethyl)-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.