CAS 1186311-06-7
:3-(Dimethoxymethyl)-5-iodopyridine
Description:
3-(Dimethoxymethyl)-5-iodopyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of the iodine atom at the 5-position of the pyridine ring contributes to its reactivity and potential applications in organic synthesis, particularly in the formation of carbon-iodine bonds. The dimethoxymethyl group at the 3-position enhances its solubility and may influence its electronic properties, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is likely to be a solid at room temperature, with potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its specific reactivity and stability would depend on the surrounding conditions, such as solvent and temperature. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact.
Formula:C8H10INO2
InChI:InChI=1S/C8H10INO2/c1-11-8(12-2)6-3-7(9)5-10-4-6/h3-5,8H,1-2H3
InChI key:InChIKey=QWDPPCPVSINUES-UHFFFAOYSA-N
SMILES:C(OC)(OC)C=1C=C(I)C=NC1
Synonyms:- 3-(Dimethoxymethyl)-5-iodopyridine
- Pyridine, 3-(dimethoxymethyl)-5-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.