CAS 1186311-07-8

2-Chloro-N-(4-hydroxy-3-pyridinyl)acetamide

Description:

2-Chloro-N-(4-hydroxy-3-pyridinyl)acetamide is a chemical compound characterized by its specific functional groups and structural features. It contains a chloro substituent, an acetamide group, and a pyridine ring with a hydroxyl group at the 4-position. This compound is typically classified as an amide due to the presence of the acetamide moiety, which contributes to its potential biological activity. The hydroxyl group on the pyridine ring can participate in hydrogen bonding, influencing the compound's solubility and reactivity. The presence of chlorine introduces additional reactivity and can affect the compound's pharmacological properties. This substance may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural characteristics that could interact with biological targets. Its specific properties, such as melting point, solubility, and stability, would depend on the molecular interactions and the environment in which it is studied. As with many chemical substances, safety and handling precautions are essential when working with this compound.

Formula: C₇H₇ClN₂O₂

InChI: InChI=1S/C7H7ClN2O2/c8-3-7(12)10-5-4-9-2-1-6(5)11/h1-2,4H,3H2,(H,9,11)(H,10,12)

InChI key: InChIKey=TVIAIJBHZUPFRB-UHFFFAOYSA-N

SMILES: N(C(CCl)=O)C=1C(O)=CC=NC1

Synonyms:

• Acetamide, 2-chloro-N-(4-hydroxy-3-pyridinyl)-
• 2-Chloro-N-(4-hydroxy-3-pyridinyl)acetamide