CAS 1186311-08-9
:3,5-Diiodo-4-pyridinyl 1,1-dimethylethyl carbonate
Description:
3,5-Diiodo-4-pyridinyl 1,1-dimethylethyl carbonate is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with two iodine atoms at the 3 and 5 positions, and a tert-butyl carbonate group. This compound is likely to exhibit properties typical of halogenated pyridines, such as increased reactivity due to the presence of iodine, which can facilitate nucleophilic substitution reactions. The tert-butyl carbonate moiety contributes to its stability and solubility in organic solvents. Additionally, the presence of the pyridine ring suggests potential applications in pharmaceuticals or agrochemicals, as pyridine derivatives are often used in drug design and synthesis. The compound may also exhibit interesting biological activities, although specific biological data would require further investigation. Overall, 3,5-Diiodo-4-pyridinyl 1,1-dimethylethyl carbonate represents a versatile structure with potential utility in various chemical applications.
Formula:C10H11I2NO3
InChI:InChI=1S/C10H11I2NO3/c1-10(2,3)16-9(14)15-8-6(11)4-13-5-7(8)12/h4-5H,1-3H3
InChI key:InChIKey=AJSQVXIEJSVQID-UHFFFAOYSA-N
SMILES:O(C(OC(C)(C)C)=O)C=1C(I)=CN=CC1I
Synonyms:- Carbonic acid, 3,5-diiodo-4-pyridinyl 1,1-dimethylethyl ester
- 3,5-Diiodo-4-pyridinyl 1,1-dimethylethyl carbonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.