CAS 1186311-09-0
:2,2-Dimethyl-N-[3-(2-propen-1-yl)-4-pyridinyl]propanamide
Description:
2,2-Dimethyl-N-[3-(2-propen-1-yl)-4-pyridinyl]propanamide is a chemical compound characterized by its unique structure, which includes a propanamide backbone with two methyl groups attached to the second carbon and a pyridine ring substituted with a propenyl group. This compound is likely to exhibit properties typical of amides, such as moderate polarity due to the presence of the amide functional group, which can engage in hydrogen bonding. The pyridine moiety may contribute to its aromatic character and potential biological activity, as many pyridine derivatives are known for their pharmacological properties. The presence of the propenyl group suggests potential for reactivity, particularly in addition reactions or polymerization processes. Additionally, the steric hindrance introduced by the dimethyl groups may influence the compound's solubility and reactivity. Overall, this compound's characteristics make it of interest in various fields, including medicinal chemistry and materials science, although specific applications would depend on further research into its biological and chemical behavior.
Formula:C13H18N2O
InChI:InChI=1S/C13H18N2O/c1-5-6-10-9-14-8-7-11(10)15-12(16)13(2,3)4/h5,7-9H,1,6H2,2-4H3,(H,14,15,16)
InChI key:InChIKey=SCQCOGSLQXRKHO-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C=1C(CC=C)=CN=CC1
Synonyms:- Propanamide, 2,2-dimethyl-N-[3-(2-propen-1-yl)-4-pyridinyl]-
- 2,2-Dimethyl-N-[3-(2-propen-1-yl)-4-pyridinyl]propanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
