CAS 1186311-11-4
:1,1-Dimethylethyl 3-[[(5-bromo-3-methoxy-2-pyridinyl)oxy]methyl]-1-pyrrolidinecarboxylate
Description:
1,1-Dimethylethyl 3-[[(5-bromo-3-methoxy-2-pyridinyl)oxy]methyl]-1-pyrrolidinecarboxylate, identified by its CAS number 1186311-11-4, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring, a pyridine moiety, and a tert-butyl group. This compound features a bromo substituent and a methoxy group on the pyridine ring, contributing to its potential biological activity. The presence of the pyrrolidinecarboxylate structure suggests it may exhibit properties relevant to medicinal chemistry, possibly acting as a ligand or a precursor in synthetic pathways. Its molecular interactions may be influenced by the electron-donating methoxy group and the electron-withdrawing bromo group, which can affect its reactivity and solubility. Additionally, the compound's stability, solubility in various solvents, and potential applications in pharmaceuticals or agrochemicals would depend on its specific functional groups and overall molecular geometry. Further studies would be necessary to elucidate its precise properties and potential uses in various fields.
Formula:C16H23BrN2O4
InChI:InChI=1S/C16H23BrN2O4/c1-16(2,3)23-15(20)19-6-5-11(9-19)10-22-14-13(21-4)7-12(17)8-18-14/h7-8,11H,5-6,9-10H2,1-4H3
InChI key:InChIKey=WTVFNKDDXNZPNR-UHFFFAOYSA-N
SMILES:O(CC1CN(C(OC(C)(C)C)=O)CC1)C2=C(OC)C=C(Br)C=N2
Synonyms:- 1,1-Dimethylethyl 3-[[(5-bromo-3-methoxy-2-pyridinyl)oxy]methyl]-1-pyrrolidinecarboxylate
- 1-Pyrrolidinecarboxylic acid, 3-[[(5-bromo-3-methoxy-2-pyridinyl)oxy]methyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.