CAS 1186311-14-7
:6-(Dimethoxymethyl)-3-methyl-3H-imidazo[4,5-b]pyridine
Description:
6-(Dimethoxymethyl)-3-methyl-3H-imidazo[4,5-b]pyridine is a heterocyclic organic compound characterized by its imidazo[4,5-b]pyridine core structure, which features a fused ring system containing nitrogen atoms. This compound typically exhibits properties associated with heterocycles, such as potential biological activity and solubility in organic solvents. The presence of dimethoxymethyl groups contributes to its chemical reactivity and may influence its pharmacological properties. The methyl group at the 3-position can affect the compound's sterics and electronic characteristics, potentially enhancing its interaction with biological targets. As a member of the imidazole family, it may exhibit properties such as basicity and the ability to participate in hydrogen bonding. The compound's specific applications and behavior in biological systems would depend on its structural features and the presence of functional groups, making it of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its full range of characteristics and potential uses.
Formula:C10H13N3O2
InChI:InChI=1S/C10H13N3O2/c1-13-6-12-8-4-7(5-11-9(8)13)10(14-2)15-3/h4-6,10H,1-3H3
InChI key:InChIKey=UIDNYSCZICDRRN-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC(C(OC)OC)=CN2)N=C1
Synonyms:- 6-(Dimethoxymethyl)-3-methyl-3H-imidazo[4,5-b]pyridine
- 3H-Imidazo[4,5-b]pyridine, 6-(dimethoxymethyl)-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.