CAS 1186311-15-8

6-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-3-methyl-3H-imidazo[4,5-b]pyridine

Description:

The chemical substance known as 6-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-3-methyl-3H-imidazo[4,5-b]pyridine, with the CAS number 1186311-15-8, is characterized by its complex molecular structure, which includes an imidazopyridine core. This compound features a dimethylsilyl group, which enhances its stability and solubility in organic solvents. The presence of the tert-butyl group contributes to its steric hindrance, potentially influencing its reactivity and interactions with biological targets. The imidazo[4,5-b]pyridine framework is known for its biological activity, often associated with pharmacological properties. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, making it of interest in medicinal chemistry. Additionally, its unique functional groups may allow for further derivatization, expanding its potential applications in drug development. Overall, this substance represents a class of compounds that could be valuable in various chemical and pharmaceutical research contexts.

Formula: C₁₄H₂₃N₃OSi

InChI: InChI=1S/C14H23N3OSi/c1-14(2,3)19(5,6)18-9-11-7-12-13(15-8-11)17(4)10-16-12/h7-8,10H,9H2,1-6H3

InChI key: InChIKey=ZRQGXPOSBWSIKN-UHFFFAOYSA-N

SMILES: CN1C=2C(=CC(CO[Si](C(C)(C)C)(C)C)=CN2)N=C1

Synonyms:

• 6-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-3-methyl-3H-imidazo[4,5-b]pyridine
• 3H-Imidazo[4,5-b]pyridine, 6-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-3-methyl-