CAS 1186311-16-9
:6-Methoxy-3-methyl-3H-imidazo[4,5-b]pyridine
Description:
6-Methoxy-3-methyl-3H-imidazo[4,5-b]pyridine is a heterocyclic organic compound characterized by its imidazo[4,5-b]pyridine core structure, which incorporates a methoxy group and a methyl group. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is soluble in organic solvents, such as dimethyl sulfoxide (DMSO) and methanol, but may have limited solubility in water. The presence of the methoxy group enhances its lipophilicity, potentially influencing its biological activity. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological properties, including activity against certain biological targets. Its molecular structure allows for various interactions with biological systems, making it a candidate for further research in drug development. As with many heterocycles, it may exhibit unique reactivity patterns, making it valuable in synthetic organic chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C8H9N3O
InChI:InChI=1S/C8H9N3O/c1-11-5-10-7-3-6(12-2)4-9-8(7)11/h3-5H,1-2H3
InChI key:InChIKey=ORZZNLBBYXYCMH-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC(OC)=CN2)N=C1
Synonyms:- 3H-Imidazo[4,5-b]pyridine, 6-methoxy-3-methyl-
- 6-Methoxy-3-methyl-3H-imidazo[4,5-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.