CAS 1186311-18-1
:1,1-Dimethylethyl 3-[[(6-iodo-3-methoxy-2-pyridinyl)oxy]methyl]-1-pyrrolidinecarboxylate
Description:
1,1-Dimethylethyl 3-[[[6-iodo-3-methoxy-2-pyridinyl]oxy]methyl]-1-pyrrolidinecarboxylate, identified by its CAS number 1186311-18-1, is a chemical compound characterized by its complex molecular structure, which includes a pyrrolidine ring and a pyridine moiety. The presence of the iodo and methoxy groups suggests potential reactivity and solubility characteristics that may influence its biological activity. This compound is likely to exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its functional groups may contribute to interactions with biological targets, potentially leading to applications in drug development. The dimethyl group attached to the carbon chain indicates steric hindrance, which can affect the compound's conformation and reactivity. Additionally, the ester functional group suggests that it may undergo hydrolysis under certain conditions, releasing the corresponding alcohol and acid. Overall, the unique structural features of this compound position it as a candidate for further investigation in various chemical and biological contexts.
Formula:C16H23IN2O4
InChI:InChI=1S/C16H23IN2O4/c1-16(2,3)23-15(20)19-8-7-11(9-19)10-22-14-12(21-4)5-6-13(17)18-14/h5-6,11H,7-10H2,1-4H3
InChI key:InChIKey=DWIGUBVOWDPBEV-UHFFFAOYSA-N
SMILES:O(CC1CN(C(OC(C)(C)C)=O)CC1)C2=C(OC)C=CC(I)=N2
Synonyms:- 1-Pyrrolidinecarboxylic acid, 3-[[(6-iodo-3-methoxy-2-pyridinyl)oxy]methyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 3-[[(6-iodo-3-methoxy-2-pyridinyl)oxy]methyl]-1-pyrrolidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.