CAS 1186311-23-8

1,1-Dimethylethyl N-[2-[(2,2-dimethyl-1-oxopropyl)amino]-3-pyridinyl]carbamate

Description:

1,1-Dimethylethyl N-[2-[(2,2-dimethyl-1-oxopropyl)amino]-3-pyridinyl]carbamate, identified by its CAS number 1186311-23-8, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by the presence of a pyridine ring, which contributes to its potential biological activity. The compound includes a dimethyl group and a carbamate functional group, which are known for their roles in various chemical reactions and biological interactions. Typically, carbamates exhibit a range of properties, including moderate solubility in organic solvents and varying degrees of stability depending on their specific structure. The presence of the pyridine moiety may impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's unique structure suggests potential applications in agrochemicals or pharmaceuticals, although specific uses would depend on further research and development. Safety and handling considerations should be taken into account, as with all chemical substances, particularly those with biological activity.

Formula: C₁₅H₂₃N₃O₃

InChI: InChI=1S/C15H23N3O3/c1-14(2,3)12(19)18-11-10(8-7-9-16-11)17-13(20)21-15(4,5)6/h7-9H,1-6H3,(H,17,20)(H,16,18,19)

InChI key: InChIKey=XYKDKZCRXCENOO-UHFFFAOYSA-N

SMILES: N(C(C(C)(C)C)=O)C1=C(NC(OC(C)(C)C)=O)C=CC=N1

Synonyms:

• 1,1-Dimethylethyl N-[2-[(2,2-dimethyl-1-oxopropyl)amino]-3-pyridinyl]carbamate
• Carbamic acid, N-[2-[(2,2-dimethyl-1-oxopropyl)amino]-3-pyridinyl]-, 1,1-dimethylethyl ester