CAS 1186403-18-8

B-(3-Amino-5-chlorophenyl)boronic acid

Description:

B-(3-Amino-5-chlorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has both an amino group and a chlorine substituent. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and alcohols, and possessing a moderate melting point. The amino group contributes to its potential as a ligand in various chemical reactions, particularly in Suzuki coupling reactions, which are vital in organic synthesis for forming carbon-carbon bonds. The chlorine atom enhances its reactivity and can serve as a site for further functionalization. Additionally, boronic acids are known for their ability to form reversible complexes with diols, making them useful in biochemical applications, including drug development and sensor technology. Overall, B-(3-Amino-5-chlorophenyl)boronic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula: C₆H₇BClNO₂

InChI: InChI=1S/C6H7BClNO2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H,9H2

InChI key: InChIKey=OXPDYMVDZZYPJS-UHFFFAOYSA-N

SMILES: B(O)(O)C1=CC(Cl)=CC(N)=C1

Synonyms:

• B-(3-Amino-5-chlorophenyl)boronic acid
• Boronic acid, B-(3-amino-5-chlorophenyl)-