CAS 1186404-82-9
:4′-Chloro-3′-fluoro[1,1′-biphenyl]-4-carboxylic acid hydrazide
Description:
4′-Chloro-3′-fluoro[1,1′-biphenyl]-4-carboxylic acid hydrazide is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid group and a hydrazide functional group indicates that this compound can participate in various chemical reactions, including those typical of carboxylic acids and hydrazides. The chlorine and fluorine substituents on the biphenyl moiety suggest that the compound may exhibit unique electronic properties and potential biological activity, as halogenated compounds often show altered reactivity and solubility. This compound may be of interest in pharmaceutical research or materials science due to its structural features. Additionally, its CAS number, 1186404-82-9, allows for precise identification in chemical databases, facilitating further study and application in various fields. Overall, the combination of functional groups and substituents makes this compound a candidate for diverse chemical investigations.
Formula:C13H10ClFN2O
InChI:InChI=1S/C13H10ClFN2O/c14-11-6-5-10(7-12(11)15)8-1-3-9(4-2-8)13(18)17-16/h1-7H,16H2,(H,17,18)
InChI key:InChIKey=WWPOOMPCKOTZOD-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1Cl)C2=CC=C(C(NN)=O)C=C2
Synonyms:- [1,1′-Biphenyl]-4-carboxylic acid, 4′-chloro-3′-fluoro-, hydrazide
- 4′-Chloro-3′-fluoro[1,1′-biphenyl]-4-carboxylic acid hydrazide
- 4-(4-chloro-3-fluorophenyl)benzohydrazide
- 4'-Chloro-3'-fluoro[1,1'-biphenyl]-4-carbohydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.