CAS 1186404-83-0
:3-Bromo-6-(trifluoromethyl)-1H-indole-5-carbonitrile
Description:
3-Bromo-6-(trifluoromethyl)-1H-indole-5-carbonitrile is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 3-position and a trifluoromethyl group at the 6-position contributes to its unique reactivity and physical properties. The carbonitrile functional group at the 5-position enhances its potential for nucleophilic reactions and increases its polarity. This compound is typically used in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. Its trifluoromethyl group can influence lipophilicity and metabolic stability, making it a valuable scaffold in drug design. Additionally, the presence of halogens often affects the compound's electronic properties, which can be crucial for interactions with biological targets. Overall, 3-Bromo-6-(trifluoromethyl)-1H-indole-5-carbonitrile is a versatile compound with significant implications in chemical synthesis and pharmacology.
Formula:C10H4BrF3N2
InChI:InChI=1S/C10H4BrF3N2/c11-8-4-16-9-2-7(10(12,13)14)5(3-15)1-6(8)9/h1-2,4,16H
InChI key:InChIKey=BVMAIEYRGNKDNF-UHFFFAOYSA-N
SMILES:BrC=1C=2C(=CC(C(F)(F)F)=C(C#N)C2)NC1
Synonyms:- 3-Bromo-6-(trifluoromethyl)-1H-indole-5-carbonitrile
- 1H-Indole-5-carbonitrile, 3-bromo-6-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Bromo-6-(trifluoromethyl)-1H-indole-5-carbonitrile
CAS:<p>3-Bromo-6-(trifluoromethyl)-1H-indole-5-carbonitrile</p>Molecular weight:289.05g/mol
