CAS 1186404-90-9

5-Thiazolecarboxylic acid, 2-[2-fluoro-4-(trifluoromethyl)phenyl]-4-methyl-

Description:

5-Thiazolecarboxylic acid, 2-[2-fluoro-4-(trifluoromethyl)phenyl]-4-methyl- is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a fluorine atom and a trifluoromethyl group on the phenyl ring enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The methyl group on the thiazole ring can affect the compound's steric properties and overall stability. This compound may exhibit various properties such as solubility in organic solvents, and its reactivity can be influenced by the electron-withdrawing effects of the fluorine substituents. Overall, the unique combination of functional groups and structural features makes this compound a candidate for further investigation in medicinal chemistry and related fields.

Formula: C₁₂H₇F₄NO₂S

InChI: InChI=1S/C12H7F4NO2S/c1-5-9(11(18)19)20-10(17-5)7-3-2-6(4-8(7)13)12(14,15)16/h2-4H,1H3,(H,18,19)

InChI key: InChIKey=PLQSFZXGFFQSBZ-UHFFFAOYSA-N

SMILES: FC1=C(C=2SC(C(O)=O)=C(C)N2)C=CC(C(F)(F)F)=C1

Synonyms:

• 2-[2-Fluoro-4-(trifluoromethyl)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid
• 2-(2-Fluoro-4-(trifluoromethyl)phenyl)-4-methylthiazole-5-carboxylic acid
• 5-Thiazolecarboxylic acid, 2-[2-fluoro-4-(trifluoromethyl)phenyl]-4-methyl-