CAS 1186404-92-1

Ethyl 5-bromo-2-[(phenylmethyl)amino]-3-pyridinecarboxylate

Description:

Ethyl 5-bromo-2-[(phenylmethyl)amino]-3-pyridinecarboxylate is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a bromine atom and an ethyl ester functional group. The presence of the phenylmethylamino group indicates that it has an amine functionality, which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic phenyl group, which may influence its solubility in organic solvents. The bromine substituent can also enhance the reactivity of the compound, making it a potential candidate for further chemical modifications. Additionally, the presence of the carboxylate group suggests that it may exhibit acidic properties, which could be relevant in biological or chemical contexts. Overall, this compound's unique structural features may contribute to its potential applications in pharmaceuticals or organic synthesis.

Formula: C₁₅H₁₅BrN₂O₂

InChI: InChI=1S/C15H15BrN2O2/c1-2-20-15(19)13-8-12(16)10-18-14(13)17-9-11-6-4-3-5-7-11/h3-8,10H,2,9H2,1H3,(H,17,18)

InChI key: InChIKey=LAJSBYOMUXYWBO-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C(NCC2=CC=CC=C2)N=CC(Br)=C1

Synonyms:

• Ethyl 5-bromo-2-[(phenylmethyl)amino]-3-pyridinecarboxylate
• 3-Pyridinecarboxylic acid, 5-bromo-2-[(phenylmethyl)amino]-, ethyl ester

Ethyl 2-(benzylamino)-5-bromonicotinate

CAS: 1186404-92-1

Ethyl 2-(benzylamino)-5-bromonicotinate

Molecular weight: 335.20g/mol

Ref: 54-OR18552