CymitQuimica logo

CAS 1186405-03-7

:

Methyl 4-amino-3-iodo-5-(phenylmethoxy)benzoate

Description:
Methyl 4-amino-3-iodo-5-(phenylmethoxy)benzoate is a chemical compound characterized by its complex structure, which includes a benzoate moiety substituted with an amino group, an iodine atom, and a phenylmethoxy group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the iodine atom may impart unique electronic properties, influencing its behavior in chemical reactions, particularly in nucleophilic substitution or coupling reactions. The amino group can participate in hydrogen bonding, enhancing its solubility in polar solvents, while the phenylmethoxy group may provide hydrophobic characteristics, affecting its overall solubility profile. Methyl 4-amino-3-iodo-5-(phenylmethoxy)benzoate may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific applications and reactivity would depend on the context of its use, including potential roles in synthesis or as a pharmacological agent. Safety and handling considerations should be observed due to the presence of iodine and the potential for biological activity.
Formula:C15H14INO3
InChI:InChI=1S/C15H14INO3/c1-19-15(18)11-7-12(16)14(17)13(8-11)20-9-10-5-3-2-4-6-10/h2-8H,9,17H2,1H3
InChI key:InChIKey=MMBLBZRROVYJKI-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=CC(C(OC)=O)=CC(I)=C2N
Synonyms:
  • Methyl 4-amino-3-iodo-5-(phenylmethoxy)benzoate
  • Methyl 4-amino-3-(benzyloxy)-5-iodobenzoate
  • Benzoic acid, 4-amino-3-iodo-5-(phenylmethoxy)-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.