CymitQuimica logo

CAS 1186405-04-8

:

4-Nitro-3-(phenylmethoxy)benzoic acid hydrazide

Description:
4-Nitro-3-(phenylmethoxy)benzoic acid hydrazide is a chemical compound characterized by its hydrazide functional group, which is derived from the reaction of hydrazine with a carboxylic acid. This compound features a nitro group and a phenylmethoxy substituent on the aromatic ring, contributing to its unique chemical properties. The presence of the nitro group typically enhances the compound's reactivity and can influence its electronic properties, making it potentially useful in various chemical reactions or as a precursor in organic synthesis. The phenylmethoxy group may impart lipophilicity, affecting the compound's solubility and biological activity. Additionally, the hydrazide moiety can participate in various chemical transformations, including condensation reactions and the formation of hydrazones. Overall, 4-Nitro-3-(phenylmethoxy)benzoic acid hydrazide is of interest in medicinal chemistry and materials science, where its structural features may be exploited for developing new pharmaceuticals or functional materials. However, specific applications and biological activities would require further investigation and research.
Formula:C14H13N3O4
InChI:InChI=1S/C14H13N3O4/c15-16-14(18)11-6-7-12(17(19)20)13(8-11)21-9-10-4-2-1-3-5-10/h1-8H,9,15H2,(H,16,18)
InChI key:InChIKey=WVDBDVOXWANDHE-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(N(=O)=O)C=CC(C(NN)=O)=C2
Synonyms:
  • Benzoic acid, 4-nitro-3-(phenylmethoxy)-, hydrazide
  • 4-Nitro-3-(phenylmethoxy)benzoic acid hydrazide
  • 3-(Benzyloxy)-4-nitrobenzenecarbohydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.