CAS 1186405-15-1
:β-Oxothieno[2,3-b]pyridine-2-propanenitrile
Description:
β-Oxothieno[2,3-b]pyridine-2-propanenitrile is a heterocyclic compound characterized by its unique structural features, which include a thieno[2,3-b]pyridine core and a β-oxoketone functional group. This compound typically exhibits a range of chemical properties due to the presence of both the nitrile and carbonyl functionalities, which can participate in various chemical reactions such as nucleophilic additions and condensation reactions. The thieno[2,3-b]pyridine moiety contributes to its potential biological activity, making it of interest in medicinal chemistry. Additionally, the compound may display moderate solubility in organic solvents, influenced by its polar functional groups. Its reactivity and stability can vary depending on the specific conditions, such as pH and temperature. Overall, β-Oxothieno[2,3-b]pyridine-2-propanenitrile is a compound of interest for further research, particularly in the fields of organic synthesis and pharmacology, where its unique structure may lead to novel applications.
Formula:C10H6N2OS
InChI:InChI=1S/C10H6N2OS/c11-4-3-8(13)9-6-7-2-1-5-12-10(7)14-9/h1-2,5-6H,3H2
InChI key:InChIKey=PLMMLXDBVSVQFN-UHFFFAOYSA-N
SMILES:C(CC#N)(=O)C1=CC=2C(S1)=NC=CC2
Synonyms:- Thieno[2,3-b]pyridine-2-propanenitrile, β-oxo-
- β-Oxothieno[2,3-b]pyridine-2-propanenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.